Products 847786-18-9
CAS 847786-18-9 is the registry number for 5-Bromo-2-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-(2,2,2-trifluoroethoxy)benzoic acid (CAS 847786-18-9) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: ADCGQOBRDPREGH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | ADCGQOBRDPREGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)