CAS 1823240-82-9 is the registry number for 2-Bromo-3-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1823240-82-9) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 2-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: BMCBLWMLFYMCCU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 2-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | BMCBLWMLFYMCCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OCC(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)