Products 1823240-82-9

CAS 1823240-82-9 is the registry number for 2-Bromo-3-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1823240-82-9) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 2-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: BMCBLWMLFYMCCU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrF3O3
Molecular weight299.04 g/mol
IUPAC name2-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid
InChIKeyBMCBLWMLFYMCCU-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)OCC(F)(F)F)Br)C(=O)O

Computed by PubChem (NCBI)