CAS 1214339-37-3 appears in our catalog under these names: 3-Bromo-5-(trifluoromethyl)mandelic acid, 95%, 2-(3-Bromo-5-(trifluoromethyl)phenyl)-2-hydroxyacetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 25g.
2-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid (CAS 1214339-37-3) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: 2-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid. InChIKey: ONDYSDOPVUUHLQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | 2-[3-bromo-5-(trifluoromethyl)phenyl]-2-hydroxyacetic acid |
| InChIKey | ONDYSDOPVUUHLQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Br)C(C(=O)O)O |
Computed by PubChem (NCBI)