Products 1807193-79-8
CAS 1807193-79-8 appears in our catalog under these names: 2-Bromo-6-(trifluoromethoxy)benzoic acid methyl ester, 95%, Methyl 2-bromo-6-(trifluoromethoxy)benzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
Methyl 2-bromo-6-(trifluoromethoxy)benzoate (CAS 1807193-79-8) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 2-bromo-6-(trifluoromethoxy)benzoate. InChIKey: LOUWLRIEZAUWIM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 2-bromo-6-(trifluoromethoxy)benzoate |
| InChIKey | LOUWLRIEZAUWIM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1Br)OC(F)(F)F |
Computed by PubChem (NCBI)