cas: 49839-81-8 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)-2-hydroxyacetic acid, 95%, 95% (CAS 49839-81-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117XX2-1g |
| cas | 49839-81-8 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1245.20 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 501.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-bromophenyl)-2-hydroxyacetic acid (CAS 49839-81-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(3-bromophenyl)-2-hydroxyacetic acid. InChIKey: CBEMVOYIUQADIA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-hydroxyacetic acid |
| InChIKey | CBEMVOYIUQADIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(=O)O)O |
Computed by PubChem (NCBI)