2-(3-Bromophenyl)thiazole-4-carboxylic acid, 98%
cas: 886369-02-4 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)thiazole-4-carboxylic acid, 98% (CAS 886369-02-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A258862-5g |
| cas | 886369-02-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 25g | 1338.25 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 514.29 Pln | |
| BLDpharm | 25g | 2269.23 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 347.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(3-bromophenyl)-1,3-thiazole-4-carboxylic acid (CAS 886369-02-4) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 2-(3-bromophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: BXGDWWUCHYPAKI-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | BXGDWWUCHYPAKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)