Products 886366-94-5
CAS 886366-94-5 appears in our catalog under these names: 4-(4-Bromophenyl)thiazole-2-carboxylic acid, 97%, 4–(4–Bromophenyl)thiazole–2–carboxylic Acid, 4-(4-Bromophenyl)thiazole-2-carboxylic Acid, >97%, >97%, 4-(4-BROMOPHENYL)THIAZOLE-2-CARBOXYLIC ACID, >97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-(4-bromophenyl)-1,3-thiazole-2-carboxylic acid (CAS 886366-94-5) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 4-(4-bromophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: JZGOVEPJNODGBT-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | JZGOVEPJNODGBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C(=O)O)Br |
Computed by PubChem (NCBI)