CAS 1019704-99-4 appears in our catalog under these names: 2-Bromo-5-phenyl-1,3-thiazole-4-carboxylic acid, 95%, 2-bromo-5-phenyl-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
2-bromo-5-phenyl-1,3-thiazole-4-carboxylic acid (CAS 1019704-99-4) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 2-bromo-5-phenyl-1,3-thiazole-4-carboxylic acid. InChIKey: UOZQPIUEUQOZML-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 2-bromo-5-phenyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | UOZQPIUEUQOZML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)Br)C(=O)O |
Computed by PubChem (NCBI)