Products 808128-00-9
CAS 808128-00-9 is the registry number for 2-Thiazolecarboxylic acid, 4-(3-bromophenyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3-bromophenyl)-1,3-thiazole-2-carboxylic acid (CAS 808128-00-9) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 4-(3-bromophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: XNJWWOHVTKHZBG-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 4-(3-bromophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | XNJWWOHVTKHZBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)