Products 955400-49-4

CAS 955400-49-4 is the registry number for 2-(2-Bromophenyl)-1,3-thiazole-4-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2-bromophenyl)-1,3-thiazole-4-carboxylic acid (CAS 955400-49-4) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 2-(2-bromophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: ZVYCBOMUAAYYML-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6BrNO2S
Molecular weight284.13 g/mol
IUPAC name2-(2-bromophenyl)-1,3-thiazole-4-carboxylic acid
InChIKeyZVYCBOMUAAYYML-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=NC(=CS2)C(=O)O)Br

Computed by PubChem (NCBI)