Products 21160-50-9
CAS 21160-50-9 is the registry number for 2-(4-Bromophenyl)thiazole-4-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid (CAS 21160-50-9) is a chemical compound with the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: FSXGZVXOAJEGDR-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2S |
|---|---|
| Molecular weight | 284.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | FSXGZVXOAJEGDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)Br |
Computed by PubChem (NCBI)