2-(3-Chloro-4-methoxyphenyl)pyrrolidine hydrochloride, 98%
cas: 1177352-21-4 — see every product listed under this CAS number, including other names
2-(3-Chloro-4-methoxyphenyl)pyrrolidine hydrochloride, 98% (CAS 1177352-21-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A830317-250mg |
| cas | 1177352-21-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1076.81 Pln | |
| BLDpharm | 25mg | 325.47 Pln | |
| BLDpharm | 50mg | 386.56 Pln | |
| BLDpharm | 100mg | 447.64 Pln | |
| BLDpharm | 250mg | 525.40 Pln | |
| BLDpharm | 1g | 1152.95 Pln | |
| Chemat | 25mg | 659.60 Pln | |
| Chemat | 50mg | 957.20 Pln | |
| Chemat | 100mg | 1389.20 Pln | |
| Chemat | 250mg | 2051.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-chloro-4-methoxyphenyl)pyrrolidine;hydrochloride (CAS 1177352-21-4) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 2-(3-chloro-4-methoxyphenyl)pyrrolidine;hydrochloride. InChIKey: UKTSFWUGXLYYBI-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 2-(3-chloro-4-methoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | UKTSFWUGXLYYBI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CCCN2)Cl.Cl |
Computed by PubChem (NCBI)