CAS 1798-83-0 appears in our catalog under these names: 1-(4-Chlorophenyl)-3-(dimethylamino)propan-1-one Hydrochloride, >95% (HPLC), 1–(4–Chlorophenyl)–3–(dimethylamino)propan–1–one Hydrochloride, 1-Propanone, 1-(4-chlorophenyl)-3-(dimethylamino)-, hydrochloride (1:1), 97%, 97%, 1-(4-Chlorophenyl)-3-(dimethylamino)propan-1-one hydrochloride, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
1-(4-chlorophenyl)-3-(dimethylamino)propan-1-one;hydrochloride (CAS 1798-83-0) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(dimethylamino)propan-1-one;hydrochloride. InChIKey: MQURAWQCJQTMJM-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(dimethylamino)propan-1-one;hydrochloride |
| InChIKey | MQURAWQCJQTMJM-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)