cas: 1172356-91-0 — see every product listed under this CAS number, including other names
2-(3-Fluorobenzyl)piperidine hydrochloride, 97% (CAS 1172356-91-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A482207-5g |
| cas | 1172356-91-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10733.38 Pln | |
| AmBeed | 1g | 3539.83 Pln | |
| AmBeed | 250mg | 1385.02 Pln | |
| AmBeed | 100mg | 753.55 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(3-fluorophenyl)methyl]piperidine;hydrochloride (CAS 1172356-91-0) is a chemical compound with the molecular formula C12H17ClFN and a molecular weight of 229.72 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]piperidine;hydrochloride. InChIKey: AUBNCLBEYQVQFB-UHFFFAOYSA-N.
| Molecular formula | C12H17ClFN |
|---|---|
| Molecular weight | 229.72 g/mol |
| IUPAC name | 2-[(3-fluorophenyl)methyl]piperidine;hydrochloride |
| InChIKey | AUBNCLBEYQVQFB-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)CC2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)