CAS 745822-33-7 appears in our catalog under these names: (S)-3-(4-Fluorobenzyl)piperidine hydrochloride, 95+%, (S)–3–(4–Fluorobenzyl)piperidine hydrochloride, (S)-3-(4-Fluorobenzyl)piperidine Hydrochloride. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,25g, 0,1g, 0,5g.
(3S)-3-[(4-fluorophenyl)methyl]piperidine;hydrochloride (CAS 745822-33-7) is a chemical compound with the molecular formula C12H17ClFN and a molecular weight of 229.72 g/mol. IUPAC name: (3S)-3-[(4-fluorophenyl)methyl]piperidine;hydrochloride. InChIKey: MVDNGUDOVPBOPT-MERQFXBCSA-N.
| Molecular formula | C12H17ClFN |
|---|---|
| Molecular weight | 229.72 g/mol |
| IUPAC name | (3S)-3-[(4-fluorophenyl)methyl]piperidine;hydrochloride |
| InChIKey | MVDNGUDOVPBOPT-MERQFXBCSA-N |
| SMILES | C1C[C@H](CNC1)CC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)