CAS 2437236-67-2 is the registry number for (S)-2-Cyclopropyl-1-(3-fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2-cyclopropyl-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride (CAS 2437236-67-2) is a chemical compound with the molecular formula C12H17ClFN and a molecular weight of 229.72 g/mol. IUPAC name: (1S)-2-cyclopropyl-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: JHRAAQPMPVIELU-YDALLXLXSA-N.
| Molecular formula | C12H17ClFN |
|---|---|
| Molecular weight | 229.72 g/mol |
| IUPAC name | (1S)-2-cyclopropyl-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | JHRAAQPMPVIELU-YDALLXLXSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@H](CC2CC2)N)F.Cl |
Computed by PubChem (NCBI)