CAS 2243513-24-6 appears in our catalog under these names: 6-Fluoro-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline hydrochloride, 6-Fluoro-2,2,4-trimethyl-1,2,3,4-tetrahydroquinoline hydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
6-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline;hydrochloride (CAS 2243513-24-6) is a chemical compound with the molecular formula C12H17ClFN and a molecular weight of 229.72 g/mol. IUPAC name: 6-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline;hydrochloride. InChIKey: DFTOVFNFQONKMO-UHFFFAOYSA-N.
| Molecular formula | C12H17ClFN |
|---|---|
| Molecular weight | 229.72 g/mol |
| IUPAC name | 6-fluoro-2,2,4-trimethyl-3,4-dihydro-1H-quinoline;hydrochloride |
| InChIKey | DFTOVFNFQONKMO-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C1C=C(C=C2)F)(C)C.Cl |
Computed by PubChem (NCBI)