Products 1171555-40-0
CAS 1171555-40-0 appears in our catalog under these names: Cyclopentyl(4-fluorophenyl)methanamine hydrochloride, 95%, Cyclopentyl(4-fluorophenyl)methanamine hydrochloride, 95+%, Cyclopentyl(4-fluorophenyl)methanamine Hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 10g, 5g, 1g, 2,5g.
Cyclopentyl-(4-fluorophenyl)methanamine;hydrochloride (CAS 1171555-40-0) is a chemical compound with the molecular formula C12H17ClFN and a molecular weight of 229.72 g/mol. IUPAC name: cyclopentyl-(4-fluorophenyl)methanamine;hydrochloride. InChIKey: MZNQZJMESMHSSY-UHFFFAOYSA-N.
| Molecular formula | C12H17ClFN |
|---|---|
| Molecular weight | 229.72 g/mol |
| IUPAC name | cyclopentyl-(4-fluorophenyl)methanamine;hydrochloride |
| InChIKey | MZNQZJMESMHSSY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C(C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)