CAS 1255705-12-4 appears in our catalog under these names: (1R,2R)-2-(4-Fluorobenzyl)cyclopentanamine hydrochloride, 97%, Rac-[(1r,2r)-2-(4-fluorobenzyl)cyclopentyl]amine hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Trans-(1R,2R)-2-[(4-fluorophenyl)methyl]cyclopentan-1-amine;hydrochloride (CAS 1255705-12-4) is a chemical compound with the molecular formula C12H17ClFN and a molecular weight of 229.72 g/mol. IUPAC name: trans-(1R,2R)-2-[(4-fluorophenyl)methyl]cyclopentan-1-amine;hydrochloride. InChIKey: LBAXGHUZSNHAJY-MHDYBILJSA-N.
| Molecular formula | C12H17ClFN |
|---|---|
| Molecular weight | 229.72 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(4-fluorophenyl)methyl]cyclopentan-1-amine;hydrochloride |
| InChIKey | LBAXGHUZSNHAJY-MHDYBILJSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)N)CC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)