2-(3-Nitrophenoxy)acetic acid, 98%
cas: 1878-88-2 — see every product listed under this CAS number, including other names
2-(3-Nitrophenoxy)acetic acid, 98% (CAS 1878-88-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A505111-1g |
| cas | 1878-88-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 25g | 654.06 Pln | |
| Ambeed | 100g | 2111.44 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 25g | 664.40 Pln | |
| Chemat | 100g | 2162.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 253.27 Pln | |
| BLDpharm | 25g | 697.56 Pln | |
| BLDpharm | 100g | 2274.78 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(3-nitrophenoxy)acetic acid (CAS 1878-88-2) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 2-(3-nitrophenoxy)acetic acid. InChIKey: BNRRQAASFDGMMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(3-nitrophenoxy)acetic acid |
| InChIKey | BNRRQAASFDGMMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
(3-Nitrophenoxy)acetic acid, 3-Nitrophenoxyacetic Acid, 2-(3-nitrophenoxy)acetic acid, M-NITROPHENOXYACETIC ACID, Acetic acid, 2-(3-nitrophenoxy)-, 2-(3-nitrophenoxy)aceticacid, (3-Nitrophenoxy)acetic acid #, 3-Nitrophenoxyacetic acid; >98%, (3-nitrophenoxy)-acetic acid, (3-nitrophenoxy) acetic acid
