Products 1878-88-2
CAS 1878-88-2 appears in our catalog under these names: 2-(3-Nitrophenoxy)acetic acid 98%, 2-(3-Nitrophenoxy)acetic acid, 98%, 98%, 3-Nitrophenoxyacetic acid, 98%, 3–Nitrophenoxyacetic Acid, 3-Nitrophenoxyacetic Acid, >98.0%(T)(GC). Offered by: Ambeed, Chemat, Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
2-(3-nitrophenoxy)acetic acid (CAS 1878-88-2) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 2-(3-nitrophenoxy)acetic acid. InChIKey: BNRRQAASFDGMMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(3-nitrophenoxy)acetic acid |
| InChIKey | BNRRQAASFDGMMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
(3-Nitrophenoxy)acetic acid, 3-Nitrophenoxyacetic Acid, 2-(3-nitrophenoxy)acetic acid, M-NITROPHENOXYACETIC ACID, Acetic acid, 2-(3-nitrophenoxy)-, 2-(3-nitrophenoxy)aceticacid, (3-Nitrophenoxy)acetic acid #, 3-Nitrophenoxyacetic acid; >98%, (3-nitrophenoxy)-acetic acid, (3-nitrophenoxy) acetic acid