CAS 861315-61-9 appears in our catalog under these names: 4-Hydroxy-3-methyl-5-nitrobenzoic acid, 95%, 4-hydroxy-3-methyl-5-nitrobenzoic acid, 4-Hydroxy-3-methyl-5-nitrobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 2,5g, 100mg.
4-hydroxy-3-methyl-5-nitrobenzoic acid (CAS 861315-61-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 4-hydroxy-3-methyl-5-nitrobenzoic acid. InChIKey: AUQMLPTXBVNUBP-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4-hydroxy-3-methyl-5-nitrobenzoic acid |
| InChIKey | AUQMLPTXBVNUBP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)