CAS 33844-21-2 appears in our catalog under these names: 4–Methoxy–2–nitrobenzoic acid, 4-Methoxy-2-nitrobenzoic acid, 98%, 2-Nitro-4-methoxybenzoic acid, 96%, 2-Nitro-4-methoxybenzoic acid, 98%, 4-Methoxy-2-nitrobenzoic Acid, >98.0%(GC)(T). Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, TCI. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
4-methoxy-2-nitrobenzoic acid (CAS 33844-21-2) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 4-methoxy-2-nitrobenzoic acid. InChIKey: DVZBWONCSHFMMM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4-methoxy-2-nitrobenzoic acid |
| InChIKey | DVZBWONCSHFMMM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)