CAS 78238-12-7 appears in our catalog under these names: 3-Methoxy-5-nitrobenzoic acid, 98%, 3-Methoxy-5-nitrobenzoic acid, 95%, 95%, 3-Methoxy-5-nitrobenzoic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 100g, 100mg, 250mg.
3-methoxy-5-nitrobenzoic acid (CAS 78238-12-7) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 3-methoxy-5-nitrobenzoic acid. InChIKey: QXIIPLXNJAJOMR-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-methoxy-5-nitrobenzoic acid |
| InChIKey | QXIIPLXNJAJOMR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)