CAS 15341-08-9 appears in our catalog under these names: 6-Nitropiperonyl alcohol, 95%, 6-Nitropiperonyl Alcohol, >95% (HPLC), 6-Nitropiperonyl alcohol, 98+% , (6-Nitrobenzo[d][1,3]dioxol-5-yl)methanol, 98%, 98%, (6-Nitrobenzo[d][1,3]dioxol-5-yl)methanol, 95%. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 25mg, 50mg, 10g, 100mg.
(6-nitro-1,3-benzodioxol-5-yl)methanol (CAS 15341-08-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: (6-nitro-1,3-benzodioxol-5-yl)methanol. InChIKey: XSKQKDTZQNFCCB-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | (6-nitro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XSKQKDTZQNFCCB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)