cas: 669713-90-0 — see every product listed under this CAS number, including other names
2-(4'-Formyl-[1,1'-biphenyl]-4-yl)acetic acid 95% (CAS 669713-90-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A650633-50mg |
| cas | 669713-90-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 553.94 Pln | |
| Ambeed | 100mg | 904.38 Pln | |
| Ambeed | 250mg | 1911.19 Pln | |
| Ambeed | 1g | 4698.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A650633 |
2-[4-(4-formylphenyl)phenyl]acetic acid (CAS 669713-90-0) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-[4-(4-formylphenyl)phenyl]acetic acid. InChIKey: VRIMIPHUAHCGAI-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-[4-(4-formylphenyl)phenyl]acetic acid |
| InChIKey | VRIMIPHUAHCGAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)