CAS 797755-07-8 appears in our catalog under these names: 2–(4–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)phenyl)acetic acid, 2-[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic Acid, >98.0%(GC)(T), 4-(Carboxymethyl)phenylboronic acid pinacol ester, 97%, 4-(CARBOXYMETHYL)PHENYLBORONIC ACID PIN&, 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid, 97%, 97%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 25g, 5g, 200mg, 100mg, 10g, 100g.
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (CAS 797755-07-8) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid. InChIKey: FNLWHBHWDXCWHV-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| InChIKey | FNLWHBHWDXCWHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)