CAS 797755-05-6 appears in our catalog under these names: 3-(Carboxymethyl)phenylboronic acid, pinacol ester, 98%, 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid, 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid 98%, 3-(Carboxymethyl)phenylboronic acid, pinacol ester, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 2,5g, 250mg, 100mg, 25g.
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (CAS 797755-05-6) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid. InChIKey: FMTLOUAINYRWAD-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| InChIKey | FMTLOUAINYRWAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)