CAS 1221343-13-0 is the registry number for Methyl 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methylbenzoate (CAS 1221343-13-0) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: methyl 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methylbenzoate. InChIKey: WTIASXRUFYFRKB-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | methyl 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-4-methylbenzoate |
| InChIKey | WTIASXRUFYFRKB-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C=CC(=C2)C(=O)OC)C |
Computed by PubChem (NCBI)