CAS 480424-68-8 appears in our catalog under these names: 2-Acetoxyphenylboronic acid, pinacol ester, 97%, 2–Acetoxyphenylboronic acid pinacol ester, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 98%, 98%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 96%+(GC-MS),RG, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 480424-68-8) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: KFBOKXXUJHAZIH-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| InChIKey | KFBOKXXUJHAZIH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OC(=O)C |
Computed by PubChem (NCBI)