CAS 2377608-70-1 appears in our catalog under these names: 4-Methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 96%, 4-Methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%, 95%, 4-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 250mg.
4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2377608-70-1) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: XSMZJBCPXNBVQY-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | XSMZJBCPXNBVQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C)C(=O)O |
Computed by PubChem (NCBI)