CAS 1356638-77-1 appears in our catalog under these names: 3-Formyl-2-methoxyphenylboronic acid pinacol ester, 96%, 2-Methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 96%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1356638-77-1) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: SYGGRAHIRANTMJ-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 2-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | SYGGRAHIRANTMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C=O)OC |
Computed by PubChem (NCBI)