CAS 143805-78-1 appears in our catalog under these names: 2-(4-(Bromomethyl)phenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95-<97%, 1,3,2-Dioxaborinane, 2-[4-(bromomethyl)phenyl]-5,5-dimethyl-, 95+%, 95+%, 1,3,2-Dioxaborinane, 2-[4-(bromomethyl)phenyl]-5,5-dimethyl-, 95+%, 2-(4-(Bromomethyl)phenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 95+%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 250mg, 5g.
2-[4-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane (CAS 143805-78-1) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: HIJSVCZXPKJRHJ-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | HIJSVCZXPKJRHJ-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)