Products 269410-06-2
CAS 269410-06-2 appears in our catalog under these names: 2-(2-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(2-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >97.0%(T), 2-(2-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Biosynth, Fluorochem, TCI, Chemat. Available pack sizes: 0,25g, 2,5g, 5g, 25g, 100g, 1g, 500g, 10g.
2-(2-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 269410-06-2) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-(2-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BQVWGVYJHSRHSD-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BQVWGVYJHSRHSD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)