CAS 68716-49-4 appears in our catalog under these names: 2-(4-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(4-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC), 1,3,2-Dioxaborolane, 2-(4-bromophenyl)-4,4,5,5-tetramethyl-, 98%, 98%. Offered by: Fluorochem, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 250mg, 50g.
2-(4-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 68716-49-4) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-(4-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AZCNDGAXOZWQPV-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AZCNDGAXOZWQPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)