CAS 594823-67-3 appears in our catalog under these names: 2-(3-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-(3-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T), 2-(3-Bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 3-Bromo-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-yl)benzene, 97%. Offered by: Ambeed, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
2-(3-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 594823-67-3) is a chemical compound with the molecular formula C12H16BBrO2 and a molecular weight of 282.97 g/mol. IUPAC name: 2-(3-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FHCWGLQDAMYXJS-UHFFFAOYSA-N.
| Molecular formula | C12H16BBrO2 |
|---|---|
| Molecular weight | 282.97 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FHCWGLQDAMYXJS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)