CAS 91902-03-3 is the registry number for 7-Methyl-5-phenylpyrazolo[1,5-a]pyrimidin-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.
7-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-2-one (CAS 91902-03-3) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 7-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-2-one. InChIKey: YHPLVWUWPHQOAW-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 7-methyl-5-phenyl-1H-pyrazolo[1,5-a]pyrimidin-2-one |
| InChIKey | YHPLVWUWPHQOAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC(=O)NN12)C3=CC=CC=C3 |
Computed by PubChem (NCBI)