Products 1152653-28-5
CAS 1152653-28-5 appears in our catalog under these names: 3-(Furan-3-yl)-1-phenyl-1h-pyrazol-5-amine, 95%, 3-(Furan-3-yl)-1-phenyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(furan-3-yl)-1-phenylpyrazol-5-amine (CAS 1152653-28-5) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 3-(furan-3-yl)-1-phenylpyrazol-5-amine. InChIKey: PZGJQUITYVFWDE-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 3-(furan-3-yl)-1-phenylpyrazol-5-amine |
| InChIKey | PZGJQUITYVFWDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C3=COC=C3)N |
Computed by PubChem (NCBI)