CAS 42832-87-1 appears in our catalog under these names: 3,6-Diamino-9(10h)-acridone, 95%, 3,6-Diamino-9(10H)-acridone, >95% (HPLC), 3,6-Diamino-9(10H)-acridone. Offered by: Combi-blocks, TRC, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 50mg, 100 mg, 250 mg, 50 mg.
3,6-diamino-10H-acridin-9-one (CAS 42832-87-1) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 3,6-diamino-10H-acridin-9-one. InChIKey: KKKYRANCRKCGDB-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 3,6-diamino-10H-acridin-9-one |
| InChIKey | KKKYRANCRKCGDB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC3=C(C2=O)C=CC(=C3)N |
Computed by PubChem (NCBI)