Products 1936044-53-9
CAS 1936044-53-9 is the registry number for 1-Benzyl-1h-pyrrolo[2,3-d]pyridazin-7(6h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-benzyl-6H-pyrrolo[2,3-d]pyridazin-7-one (CAS 1936044-53-9) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 1-benzyl-6H-pyrrolo[2,3-d]pyridazin-7-one. InChIKey: OKPAQVDUXXJLBG-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 1-benzyl-6H-pyrrolo[2,3-d]pyridazin-7-one |
| InChIKey | OKPAQVDUXXJLBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=C2C(=O)NN=C3 |
Computed by PubChem (NCBI)