cas: 99548-57-9 — see every product listed under this CAS number, including other names
2-(4-Bromo-3-methoxyphenyl)acetic acid 95% (CAS 99548-57-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A334885-50mg |
| cas | 99548-57-9 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 231.31 Pln | |
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1254.81 Pln | |
| Ambeed | 5g | 2806.75 Pln | |
| Ambeed | 10g | 4725.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A334885 |
2-(4-bromo-3-methoxyphenyl)acetic acid (CAS 99548-57-9) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)acetic acid. InChIKey: XAELQZLYEDCMJI-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)acetic acid |
| InChIKey | XAELQZLYEDCMJI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(=O)O)Br |
Computed by PubChem (NCBI)