Products 99548-57-9
CAS 99548-57-9 appears in our catalog under these names: (4-Bromo-3-methoxyphenyl)acetic acid, 95%, Benzeneacetic acid, 4-bromo-3-methoxy-, 2-(4-Bromo-3-methoxyphenyl)acetic acid 95%, 4-Bromo-3-methoxybenzeneacetic acid, 95%, 95%, 2-(4-Bromo-3-methoxyphenyl)acetic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 5g, 50mg, 10g.
2-(4-bromo-3-methoxyphenyl)acetic acid (CAS 99548-57-9) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)acetic acid. InChIKey: XAELQZLYEDCMJI-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)acetic acid |
| InChIKey | XAELQZLYEDCMJI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(=O)O)Br |
Computed by PubChem (NCBI)