cas: 40641-90-5 — see every product listed under this CAS number, including other names
2-(4-CYCLOPROPYLPHENYL)ACETIC ACID, 98% (CAS 40641-90-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468771-100MG |
| cas | 40641-90-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 497.76 Pln | |
| Fluorochem | 250mg | 784.12 Pln | |
| Fluorochem | 1g | 2002.44 Pln | |
| Fluorochem | 5g | 6193.67 Pln | |
| Fluorochem | 25g | 20318.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-cyclopropylphenyl)acetic acid (CAS 40641-90-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-(4-cyclopropylphenyl)acetic acid. InChIKey: GPLBEAZWBXIBCQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-(4-cyclopropylphenyl)acetic acid |
| InChIKey | GPLBEAZWBXIBCQ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)