CAS 7417-89-2 appears in our catalog under these names: 2–(4–Chloro–2–hydroxyphenoxy)acetic acid, 2-(4-Chloro-2-hydroxyphenoxy)acetic acid, 95%, 2-(4-Chloro-2-hydroxyphenoxy)acetic acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chloro-2-hydroxyphenoxy)acetic acid (CAS 7417-89-2) is a chemical compound with the molecular formula C8H7ClO4 and a molecular weight of 202.59 g/mol. IUPAC name: 2-(4-chloro-2-hydroxyphenoxy)acetic acid. InChIKey: IJMOEYYLLVJVAS-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 2-(4-chloro-2-hydroxyphenoxy)acetic acid |
| InChIKey | IJMOEYYLLVJVAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)OCC(=O)O |
Computed by PubChem (NCBI)