Products 278805-36-0

CAS 278805-36-0 is the registry number for Methyl 5-chloro-2,3-dihydroxybenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-chloro-2,3-dihydroxybenzoate (CAS 278805-36-0) is a chemical compound with the molecular formula C8H7ClO4 and a molecular weight of 202.59 g/mol. IUPAC name: methyl 5-chloro-2,3-dihydroxybenzoate. InChIKey: NWLWOSLKONPRKX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO4
Molecular weight202.59 g/mol
IUPAC namemethyl 5-chloro-2,3-dihydroxybenzoate
InChIKeyNWLWOSLKONPRKX-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC(=C1)Cl)O)O

Computed by PubChem (NCBI)