Products 1378866-39-7

CAS 1378866-39-7 is the registry number for 5-chloro-2-hydroxy-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

5-chloro-2-hydroxy-4-methoxybenzoic acid (CAS 1378866-39-7) is a chemical compound with the molecular formula C8H7ClO4 and a molecular weight of 202.59 g/mol. IUPAC name: 5-chloro-2-hydroxy-4-methoxybenzoic acid. InChIKey: HZIKPKZWRLUJOH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClO4
Molecular weight202.59 g/mol
IUPAC name5-chloro-2-hydroxy-4-methoxybenzoic acid
InChIKeyHZIKPKZWRLUJOH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)O)C(=O)O)Cl

Computed by PubChem (NCBI)