CAS 14771-02-9 is the registry number for Noradrenaline (Norepinephrine) Impurity 90. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(2,4,5-trihydroxyphenyl)ethanone (CAS 14771-02-9) is a chemical compound with the molecular formula C8H7ClO4 and a molecular weight of 202.59 g/mol. IUPAC name: 2-chloro-1-(2,4,5-trihydroxyphenyl)ethanone. InChIKey: FPHUGJRDNMGIHN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 2-chloro-1-(2,4,5-trihydroxyphenyl)ethanone |
| InChIKey | FPHUGJRDNMGIHN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1O)O)O)C(=O)CCl |
Computed by PubChem (NCBI)