CAS 1379332-50-9 is the registry number for Methyl 4-chloro-3,5-dihydroxybenzoate, 95%. Offered by: AmBeed. Available pack sizes: 100mg.
Methyl 4-chloro-3,5-dihydroxybenzoate (CAS 1379332-50-9) is a chemical compound with the molecular formula C8H7ClO4 and a molecular weight of 202.59 g/mol. IUPAC name: methyl 4-chloro-3,5-dihydroxybenzoate. InChIKey: KCLHTSDISVJYNQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | methyl 4-chloro-3,5-dihydroxybenzoate |
| InChIKey | KCLHTSDISVJYNQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)O)Cl)O |
Computed by PubChem (NCBI)