CAS 1311317-83-5 appears in our catalog under these names: 4-(2-Chloroacetyl)-5-methylfuran-2-carboxylic acid, 95%, 4-(2-Chloroacetyl)-5-methylfuran-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(2-chloroacetyl)-5-methylfuran-2-carboxylic acid (CAS 1311317-83-5) is a chemical compound with the molecular formula C8H7ClO4 and a molecular weight of 202.59 g/mol. IUPAC name: 4-(2-chloroacetyl)-5-methylfuran-2-carboxylic acid. InChIKey: ZGZNFCAAUDQIBP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO4 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 4-(2-chloroacetyl)-5-methylfuran-2-carboxylic acid |
| InChIKey | ZGZNFCAAUDQIBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C(=O)O)C(=O)CCl |
Computed by PubChem (NCBI)