cas: 886501-02-6 — see every product listed under this CAS number, including other names
2-(4-Chloro-3-(trifluoromethoxy)phenyl)acetic acid, 98%, 98% (CAS 886501-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L5B-100mg |
| cas | 886501-02-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 861.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-chloro-3-(trifluoromethoxy)phenyl]acetic acid (CAS 886501-02-6) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 2-[4-chloro-3-(trifluoromethoxy)phenyl]acetic acid. InChIKey: JLISEZFNOVSYFN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 2-[4-chloro-3-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | JLISEZFNOVSYFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)